Norflutiorex
1-{3-[(Trifluoromethyl)sulfanyl]phenyl}propan-2-amine
 10511  C10H12F3NS  235.269
 InChI=1S/C10H12F3NS/c1-7(14)5-8-3-2-4-9(6-8)15-10(11,12)13/h2-4,6-7H,5,14H2,1H3
 KNAYQGVZGNYISX-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1cccc(c1)SC(F)(F)F)N