N-Ethyl-1-[3-(trifluoromethoxy)phenyl]propan-2-amine
 10509  C12H16F3NO  247.257
 InChI=1S/C12H16F3NO/c1-3-16-9(2)7-10-5-4-6-11(8-10)17-12(13,14)15/h4-6,8-9,16H,3,7H2,1-2H3
 RMECOAGRPWRBCA-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCNC(Cc1cccc(c1)OC(F)(F)F)C