N-[1-(3-Bromophenyl)propan-2-yl]-3-phenylpropan-1-amine
 10505  C18H22BrN  332.278
 InChI=1S/C18H22BrN/c1-15(13-17-9-5-11-18(19)14-17)20-12-6-10-16-7-3-2-4-8-16/h2-5,7-9,11,14-15,20H,6,10,12-13H2,1H3
 NHJVAVYZOZXLHF-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1cccc(c1)Br)NCCCc1ccccc1