[1-(3-Chlorophenyl)propan-2-yl]hydrazine
 10503  C9H13ClN2  184.666
 InChI=1S/C9H13ClN2/c1-7(12-11)5-8-3-2-4-9(10)6-8/h2-4,6-7,12H,5,11H2,1H3
 OBRDCSSSDNLWTA-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NNC(Cc1cccc(c1)Cl)C