3-Phenyl-N-{1-[3-(trifluoromethyl)phenyl]propan-2-yl}propan-1-amine
 10496  C19H22F3N  321.38
 InChI=1S/C19H22F3N/c1-15(23-12-6-10-16-7-3-2-4-8-16)13-17-9-5-11-18(14-17)19(20,21)22/h2-5,7-9,11,14-15,23H,6,10,12-13H2,1H3
 QQJPJXPWFWDIGG-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1cccc(c1)C(F)(F)F)NCCCc1ccccc1