1,1,1-Trifluoro-3-(3-methoxyphenyl)propan-2-amine
 10491  C10H12F3NO  219.204
 InChI=1S/C10H12F3NO/c1-15-8-4-2-3-7(5-8)6-9(14)10(11,12)13/h2-5,9H,6,14H2,1H3
 PZKMALZJIUFODA-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cccc(c1)CC(C(F)(F)F)N