Clorprenaline
1-(2-Chlorophenyl)-2-[(propan-2-yl)amino]ethan-1-ol
 10483  C11H16ClNO  213.704
 InChI=1S/C11H16ClNO/c1-8(2)13-7-11(14)9-5-3-4-6-10(9)12/h3-6,8,11,13-14H,7H2,1-2H3
 SSMSBSWKLKKXGG-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(NCC(c1ccccc1Cl)O)C