1-(2-Iodophenyl)-N-methylpropan-2-amine
 10479  C10H14IN  275.129
 InChI=1S/C10H14IN/c1-8(12-2)7-9-5-3-4-6-10(9)11/h3-6,8,12H,7H2,1-2H3
 BNVVEJKUYYWZNZ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNC(Cc1ccccc1I)C