N-[2-(2-Methoxyphenyl)ethyl]acetamide
 10474 C11H15NO2 193.242
 InChI=1S/C11H15NO2/c1-9(13)12-8-7-10-5-3-4-6-11(10)14-2/h3-6H,7-8H2,1-2H3,(H,12,13)
 KYWSQJQPFHBYJL-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1ccccc1CCNC(=O)C