Convolutamine H
N-Methyl-2-(2,3,4-tribromo-5,6-dimethoxyphenyl)ethan-1-amine
 10472  C11H14Br3NO2  431.946
 InChI=1S/C11H14Br3NO2/c1-15-5-4-6-7(12)8(13)9(14)11(17-3)10(6)16-2/h15H,4-5H2,1-3H3
 TXBNYKFQXDKTHG-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNCCc1c(Br)c(Br)c(c(c1OC)OC)Br