1-(2,3,5,6-Tetrafluoro-4-methoxyphenyl)propan-2-amine
 10466  C10H11F4NO  237.194
 InChI=1S/C10H11F4NO/c1-4(15)3-5-6(11)8(13)10(16-2)9(14)7(5)12/h4H,3,15H2,1-2H3
 AMYAJHYQECJIGY-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1c(F)c(F)c(c(c1F)F)CC(N)C