2-(3,5-Dibromo-2,4,6-trimethoxyphenyl)ethan-1-amine
 10462 C11H15Br2NO3 369.05
 InChI=1S/C11H15Br2NO3/c1-15-9-6(4-5-14)10(16-2)8(13)11(17-3)7(9)12/h4-5,14H2,1-3H3
 GPGNUYXGASQYRQ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1c(OC)c(Br)c(c(c1OC)Br)OC