Homoamphetamine
4-Phenylbutan-2-amine
 1045 C10H15N 149.233
 InChI=1S/C10H15N/c1-9(11)7-8-10-5-3-2-4-6-10/h2-6,9H,7-8,11H2,1H3
 WECUIGDEWBNQJJ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(CCc1ccccc1)N