DMe-M
2-(3,4,5-Trimethoxy-2,6-dimethylphenyl)ethan-1-amine
 10440 C13H21NO3 239.311
 InChI=1S/C13H21NO3/c1-8-10(6-7-14)9(2)12(16-4)13(17-5)11(8)15-3/h6-7,14H2,1-5H3
 VUZBXFVHLMPADZ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1c(C)c(OC)c(c(c1C)OC)OC