1-(2,5-Dimethoxy-3,6-dimethylphenyl)propan-2-amine
 10439 C13H21NO2 223.311
 InChI=1S/C13H21NO2/c1-8-6-12(15-4)10(3)11(7-9(2)14)13(8)16-5/h6,9H,7,14H2,1-5H3
 WMLHRAWTRMGILO-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(C)c(c(c1C)CC(N)C)OC