2-(2,5-Dimethoxy-3,6-dimethylphenyl)ethan-1-amine
 10432 C12H19NO2 209.285
 InChI=1S/C12H19NO2/c1-8-7-11(14-3)9(2)10(5-6-13)12(8)15-4/h7H,5-6,13H2,1-4H3
 HSUSVIABFKDMLY-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1c(C)c(OC)cc(c1OC)C