2,2′-(2,4,6-Triethyl-1,3-phenylene)di(ethan-1-amine)
 10428  C16H28N2  248.407
 InChI=1S/C16H28N2/c1-4-12-11-13(5-2)16(8-10-18)14(6-3)15(12)7-9-17/h11H,4-10,17-18H2,1-3H3
 CLMQQXVKWQWVGM-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1c(CC)cc(c(c1CC)CCN)CC