2,2′-(2,4,6-Trimethyl-1,3-phenylene)di(ethan-1-amine)
 10426  C13H22N2  206.327
 InChI=1S/C13H22N2/c1-9-8-10(2)13(5-7-15)11(3)12(9)4-6-14/h8H,4-7,14-15H2,1-3H3
 RSAORNVSSRJNNL-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1c(C)cc(c(c1C)CCN)C