2-(6-Bromo-3-methoxy-2,4-dimethylphenyl)ethan-1-amine
 10419  C11H16BrNO  258.155
 InChI=1S/C11H16BrNO/c1-7-6-10(12)9(4-5-13)8(2)11(7)14-3/h6H,4-5,13H2,1-3H3
 DSAYCPXYFDEUNP-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1c(Br)cc(c(c1C)OC)C