3-(2-Aminoethyl)-2,4,6-tribromophenol
 10418  C8H8Br3NO  373.867
 InChI=1S/C8H8Br3NO/c9-5-3-6(10)8(13)7(11)4(5)1-2-12/h3,13H,1-2,12H2
 HAYLPXZJOVQYFP-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1c(Br)cc(c(c1Br)O)Br