2-{6-Bromo-3,4-dimethoxy-2-[(propan-2-yl)oxy]phenyl}ethan-1-amine
 10417  C13H20BrNO3  318.207
 InChI=1S/C13H20BrNO3/c1-8(2)18-12-9(5-6-15)10(14)7-11(16-3)13(12)17-4/h7-8H,5-6,15H2,1-4H3
 ILYFWSNGNMTOIC-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1c(Br)cc(c(c1OC(C)C)OC)OC