Convolutamine F
N-Methyl-2-(2,4,6-tribromo-3-methoxyphenyl)ethan-1-amine
 10416 C10H12Br3NO 401.92
 InChI=1S/C10H12Br3NO/c1-14-4-3-6-7(11)5-8(12)10(15-2)9(6)13/h5,14H,3-4H2,1-2H3
 PVBUUBRHBMVTOK-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNCCc1c(Br)cc(c(c1Br)OC)Br