Convolutamine C
1-{Methyl[2-(2,4,6-tribromo-3-methoxyphenyl)ethyl]amino}propan-2-ol
 10415  C13H18Br3NO2  460
 InChI=1S/C13H18Br3NO2/c1-8(18)7-17(2)5-4-9-10(14)6-11(15)13(19-3)12(9)16/h6,8,18H,4-5,7H2,1-3H3
 FLXJEWXCEATYOS-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1c(Br)cc(c(c1Br)CCN(CC(O)C)C)Br