Convolutamine A
1-{[2-(2,4,6-Tribromo-3-methoxyphenyl)ethyl]amino}propan-2-ol
 10414  C12H16Br3NO2  445.973
 InChI=1S/C12H16Br3NO2/c1-7(17)6-16-4-3-8-9(13)5-10(14)12(18-2)11(8)15/h5,7,16-17H,3-4,6H2,1-2H3
 NPRBTDVEJQEGKD-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1c(Br)cc(c(c1Br)CCNCC(O)C)Br