2C-DB
2-(2,4-Dibromo-3,6-dimethoxyphenyl)ethan-1-amine
 10413 C10H13Br2NO2 339.024
 InChI=1S/C10H13Br2NO2/c1-14-8-5-7(11)10(15-2)9(12)6(8)3-4-13/h5H,3-4,13H2,1-2H3
 ISCLQOQPPGRPTK-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1c(OC)cc(c(c1Br)OC)Br