6-(2-Aminopropyl)-2,4-dimethoxy-3-methylphenol
 10411 C12H19NO3 225.284
 InChI=1S/C12H19NO3/c1-7(13)5-9-6-10(15-3)8(2)12(16-4)11(9)14/h6-7,14H,5,13H2,1-4H3
 YLTMORRYULMWBF-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(CC(N)C)c(c(c1C)OC)O