2-(2,4,5-Trimethoxy-3-methylphenyl)ethan-1-amine
 10406 C12H19NO3 225.284
 InChI=1S/C12H19NO3/c1-8-11(15-3)9(5-6-13)7-10(14-2)12(8)16-4/h7H,5-6,13H2,1-4H3
 WHSIBBGTBQJYTA-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC)c(c(c1OC)C)OC