2-(2-Ethyl-3,4,5-trimethoxyphenyl)ethan-1-amine
 10404 C13H21NO3 239.311
 InChI=1S/C13H21NO3/c1-5-10-9(6-7-14)8-11(15-2)13(17-4)12(10)16-3/h8H,5-7,14H2,1-4H3
 HMXOMXBCVNEAOC-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC)c(c(c1CC)OC)OC