Varacin A
2-(6,7-Dimethoxy-1,2,3-benzotrithiol-4-yl)ethan-1-amine
 10389 C10H13NO2S3 275.411
 InChI=1S/C10H13NO2S3/c1-12-7-5-6(3-4-11)9-10(8(7)13-2)15-16-14-9/h5H,3-4,11H2,1-2H3
 UNCWRRPZMNUQDN-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC)c(c2c1SSS2)OC