Lissoclinotoxin A
9-(2-Aminoethyl)-6-methoxy-1,2,3,4,5-benzopentathiepin-7-ol
 10384 C9H11NO2S5 325.514
 InChI=1S/C9H11NO2S5/c1-12-7-6(11)4-5(2-3-10)8-9(7)14-16-17-15-13-8/h4,11H,2-3,10H2,1H3
 WQAHCFFHBFQTRE-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(O)c(c2c1SSSSS2)OC