BR-TMA-6
1-(3-Bromo-2,4,6-trimethoxyphenyl)propan-2-amine
 10376 C12H18BrNO3 304.18
 InChI=1S/C12H18BrNO3/c1-7(14)5-8-9(15-2)6-10(16-3)11(13)12(8)17-4/h6-7H,5,14H2,1-4H3
 VRLVWYWOMRJREE-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(OC)c(c(c1CC(N)C)OC)Br