DODB
1-(2,4-Dibromo-3,6-dimethoxyphenyl)propan-2-amine
 10375 C11H15Br2NO2 353.05
 InChI=1S/C11H15Br2NO2/c1-6(14)4-7-9(15-2)5-8(12)11(16-3)10(7)13/h5-6H,4,14H2,1-3H3
 MFEJTCMFVXAELO-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1c(Br)cc(c(c1Br)CC(N)C)OC