METHYL-DOET
1-(4-Ethyl-2,5-dimethoxyphenyl)-N-methylpropan-2-amine
 10356 C14H23NO2 237.338
 InChI=1S/C14H23NO2/c1-6-11-8-14(17-5)12(7-10(2)15-3)9-13(11)16-4/h8-10,15H,6-7H2,1-5H3
 RQQHOPRRBXCSOF-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNC(Cc1cc(OC)c(cc1OC)CC)C