BMB
2-(4-Bromo-2,5-dimethoxyphenyl)propan-1-amine
 10355 C11H16BrNO2 274.154
 InChI=1S/C11H16BrNO2/c1-7(6-13)8-4-11(15-3)9(12)5-10(8)14-2/h4-5,7H,6,13H2,1-3H3
 YJJFYOKEGOFNFA-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCC(c1cc(OC)c(cc1OC)Br)C