2C-T-29
2-{2,5-Dimethoxy-4-[(prop-2-yn-1-yl)sulfanyl]phenyl}ethan-1-amine
 10346  C13H17NO2S  251.345
 InChI=1S/C13H17NO2S/c1-4-7-17-13-9-11(15-2)10(5-6-14)8-12(13)16-3/h1,8-9H,5-7,14H2,2-3H3
 BWTBPZDUQOTNBE-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC)c(cc1OC)SCC#C