2C-T-26
2-{4-[(1,3-Difluoropropan-2-yl)sulfanyl]-2,5-dimethoxyphenyl}ethan-1-amine
 10345  C13H19F2NO2S  291.357
 InChI=1S/C13H19F2NO2S/c1-17-11-6-13(19-10(7-14)8-15)12(18-2)5-9(11)3-4-16/h5-6,10H,3-4,7-8,16H2,1-2H3
 XJYZRFRFIBYEGO-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC)c(cc1OC)SC(CF)CF