2C-T-24
N-{[4-(2-Aminoethyl)-2,5-dimethoxyphenyl]sulfanyl}-N-ethylethanamine
 10344  C14H24N2O2S  284.418
 InChI=1S/C14H24N2O2S/c1-5-16(6-2)19-14-10-12(17-3)11(7-8-15)9-13(14)18-4/h9-10H,5-8,15H2,1-4H3
 FIAMOCZVOLEOOH-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC)c(cc1OC)SN(CC)CC