2-[4-(Heptylsulfanyl)-2,5-dimethoxyphenyl]ethan-1-amine
 10343  C17H29NO2S  311.483
 InChI=1S/C17H29NO2S/c1-4-5-6-7-8-11-21-17-13-15(19-2)14(9-10-18)12-16(17)20-3/h12-13H,4-11,18H2,1-3H3
 REBXQPVZSBYZLJ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCCCCCSc1cc(OC)c(cc1OC)CCN