2-[2,5-Dimethoxy-4-(pentylsulfanyl)phenyl]ethan-1-amine
 10342  C15H25NO2S  283.43
 InChI=1S/C15H25NO2S/c1-4-5-6-9-19-15-11-13(17-2)12(7-8-16)10-14(15)18-3/h10-11H,4-9,16H2,1-3H3
 SPHRAOZAEYDNOD-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCCCSc1cc(OC)c(cc1OC)CCN