2C-T-35
2-{4-[(Difluoromethyl)sulfanyl]-2,5-dimethoxyphenyl}ethan-1-amine
 10340  C11H15F2NO2S  263.304
 InChI=1S/C11H15F2NO2S/c1-15-8-6-10(17-11(12)13)9(16-2)5-7(8)3-4-14/h5-6,11H,3-4,14H2,1-2H3
 IMXLEUNJGUBEMC-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC)c(cc1OC)SC(F)F