2C-T-34
2-{4-[(Fluoromethyl)sulfanyl]-2,5-dimethoxyphenyl}ethan-1-amine
 10339  C11H16FNO2S  245.314
 InChI=1S/C11H16FNO2S/c1-14-9-6-11(16-7-12)10(15-2)5-8(9)3-4-13/h5-6H,3-4,7,13H2,1-2H3
 PKEZPWSDPCSUHY-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC)c(cc1OC)SCF