DODFM
1-[4-(Difluoromethyl)-2,5-dimethoxyphenyl]propan-2-amine
 10325  C12H17F2NO2  245.266
 InChI=1S/C12H17F2NO2/c1-7(15)4-8-5-11(17-3)9(12(13)14)6-10(8)16-2/h5-7,12H,4,15H2,1-3H3
 XYYQXWZABLBGLQ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(C(F)F)c(cc1CC(N)C)OC