DOPF
1-[4-(3-Fluoropropyl)-2,5-dimethoxyphenyl]propan-2-amine
 10323  C14H22FNO2  255.328
 InChI=1S/C14H22FNO2/c1-10(16)7-12-9-13(17-2)11(5-4-6-15)8-14(12)18-3/h8-10H,4-7,16H2,1-3H3
 UIHSFMYQJAKMHD-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 FCCCc1cc(OC)c(cc1OC)CC(N)C