2C-FV
2-[4-(1-Fluoroethenyl)-2,5-dimethoxyphenyl]ethan-1-amine
 10319  C12H16FNO2  225.259
 InChI=1S/C12H16FNO2/c1-8(13)10-7-11(15-2)9(4-5-14)6-12(10)16-3/h6-7H,1,4-5,14H2,2-3H3
 PPMVIGODWANSFG-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC)c(cc1OC)C(=C)F