2C-DFM
2-[4-(Difluoromethyl)-2,5-dimethoxyphenyl]ethan-1-amine
 10317  C11H15F2NO2  231.239
 Prophetic?
 InChI=1S/C11H15F2NO2/c1-15-9-6-8(11(12)13)10(16-2)5-7(9)3-4-14/h5-6,11H,3-4,14H2,1-2H3
 NACANDWMBXGSTD-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC)c(cc1OC)C(F)F