2C-BU
2-(4-Butyl-2,5-dimethoxyphenyl)ethan-1-amine
 10307 C14H23NO2 237.338
 InChI=1S/C14H23NO2/c1-4-5-6-11-9-14(17-3)12(7-8-15)10-13(11)16-2/h9-10H,4-8,15H2,1-3H3
 WVGDKSDIKCPRKV-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCCc1cc(OC)c(cc1OC)CCN