Hydrocotarnine
4-Methoxy-6-methyl-5,6,7,8-tetrahydro-2H-[1,3]dioxolo[4,5-g]isoquinoline
 10257 C12H15NO3 221.252
 InChI=1S/C12H15NO3/c1-13-4-3-8-5-10-12(16-7-15-10)11(14-2)9(8)6-13/h5H,3-4,6-7H2,1-2H3
 XXANNZJIZQTCBP-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1c2CN(C)CCc2cc2c1OCO2