FLA 365
4-(2-Aminopropyl)-3,5-dichloro-N,N-dimethylaniline
 10251  C11H16Cl2N2  247.164
 InChI=1S/C11H16Cl2N2/c1-7(14)4-9-10(12)5-8(15(2)3)6-11(9)13/h5-7H,4,14H2,1-3H3
 DWBMENXBKOCHLV-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1c(Cl)cc(cc1Cl)N(C)C)N