1-(2,4,6-Trifluorophenyl)propan-2-amine
 10250 C9H10F3N 189.178
 InChI=1S/C9H10F3N/c1-5(13)2-7-8(11)3-6(10)4-9(7)12/h3-5H,2,13H2,1H3
 NIEPRHZEHULLHV-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1c(F)cc(cc1F)F)N