1-(2,4,6-Trichlorophenyl)propan-2-amine
 10249  C9H10Cl3N  238.541
 InChI=1S/C9H10Cl3N/c1-5(13)2-7-8(11)3-6(10)4-9(7)12/h3-5H,2,13H2,1H3
 CLIWDOARUJGESL-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1c(Cl)cc(cc1Cl)Cl)N